Products 1256156-45-2
CAS 1256156-45-2 is the registry number for 2-({((tert-Butoxy)carbonyl)amino}methyl)furan-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-3-carboxylic acid (CAS 1256156-45-2) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-3-carboxylic acid. InChIKey: NJYUCVXLDQXPBZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-3-carboxylic acid |
| InChIKey | NJYUCVXLDQXPBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=CO1)C(=O)O |
Computed by PubChem (NCBI)