CAS 125660-99-3 appears in our catalog under these names: 4-Chloro-2-methyl-6-phenylthieno[2,3-d]pyrimidine, 95%, 4-chloro-2-methyl-6-phenylthieno(2,3-d)pyrimidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 0,5g.
4-chloro-2-methyl-6-phenylthieno[2,3-d]pyrimidine (CAS 125660-99-3) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 4-chloro-2-methyl-6-phenylthieno[2,3-d]pyrimidine. InChIKey: BPICMBSKTMUFHY-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-phenylthieno[2,3-d]pyrimidine |
| InChIKey | BPICMBSKTMUFHY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(S2)C3=CC=CC=C3)C(=N1)Cl |
Computed by PubChem (NCBI)