CAS 53544-78-8 appears in our catalog under these names: 2-(4-Chlorophenyl)-1,3-benzothiazol-6-amine, 95%, 2-(4-Chlorophenyl)-1,3-benzothiazol-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(4-chlorophenyl)-1,3-benzothiazol-6-amine (CAS 53544-78-8) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-benzothiazol-6-amine. InChIKey: ATTFNIVPYMRDEI-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-benzothiazol-6-amine |
| InChIKey | ATTFNIVPYMRDEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(S2)C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)