CAS 292644-36-1 is the registry number for 3-Benzothiazol-2-yl-4-chloro-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(1,3-benzothiazol-2-yl)-4-chloroaniline (CAS 292644-36-1) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)-4-chloroaniline. InChIKey: GDZBKIWVWVAQEK-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-yl)-4-chloroaniline |
| InChIKey | GDZBKIWVWVAQEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=C(C=CC(=C3)N)Cl |
Computed by PubChem (NCBI)