CAS 306934-78-1 appears in our catalog under these names: 4-Chloro-5-methyl-6-phenylthieno[2,3-d]pyrimidine, 95%, 4-Chloro-5-methyl-6-phenylthieno(2,3-d)pyrimidine, 4-Chloro-5-methyl-6-phenylthieno[2,3-d]pyrimidine, 97% . Offered by: Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 1g, 10g, 250mg, 2,5g.
4-chloro-5-methyl-6-phenylthieno[2,3-d]pyrimidine (CAS 306934-78-1) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 4-chloro-5-methyl-6-phenylthieno[2,3-d]pyrimidine. InChIKey: LRTKDTZXCFGPEU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 4-chloro-5-methyl-6-phenylthieno[2,3-d]pyrimidine |
| InChIKey | LRTKDTZXCFGPEU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC=N2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)