CAS 1267224-50-9 is the registry number for 2-(3-Chlorophenyl)-1,3-benzothiazol-6-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-chlorophenyl)-1,3-benzothiazol-6-amine (CAS 1267224-50-9) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,3-benzothiazol-6-amine. InChIKey: XSUQSBHGQBCFCR-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,3-benzothiazol-6-amine |
| InChIKey | XSUQSBHGQBCFCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC3=C(S2)C=C(C=C3)N |
Computed by PubChem (NCBI)