CAS 53088-07-6 appears in our catalog under these names: N-(2-Chlorophenyl)-1,3-benzothiazol-2-amine, 95%, N-(2-Chlorophenyl)benzo(d)thiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-(2-chlorophenyl)-1,3-benzothiazol-2-amine (CAS 53088-07-6) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: N-(2-chlorophenyl)-1,3-benzothiazol-2-amine. InChIKey: NBVIHPVVWLJJKV-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | N-(2-chlorophenyl)-1,3-benzothiazol-2-amine |
| InChIKey | NBVIHPVVWLJJKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)