CAS 791595-81-8 is the registry number for 6-(2-Chlorophenyl)benzo[d]thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2-chlorophenyl)-1,3-benzothiazol-2-amine (CAS 791595-81-8) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 6-(2-chlorophenyl)-1,3-benzothiazol-2-amine. InChIKey: MVPYWLSQKSQQRP-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 6-(2-chlorophenyl)-1,3-benzothiazol-2-amine |
| InChIKey | MVPYWLSQKSQQRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC3=C(C=C2)N=C(S3)N)Cl |
Computed by PubChem (NCBI)