Products 1256788-25-6

CAS 1256788-25-6 is the registry number for Methyl 4-methoxy-6-methylpyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-methoxy-6-methylpyridine-3-carboxylate (CAS 1256788-25-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 4-methoxy-6-methylpyridine-3-carboxylate. InChIKey: MXYUSCVVFZGUIS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO3
Molecular weight181.19 g/mol
IUPAC namemethyl 4-methoxy-6-methylpyridine-3-carboxylate
InChIKeyMXYUSCVVFZGUIS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=N1)C(=O)OC)OC

Computed by PubChem (NCBI)