Products 1256806-61-7
CAS 1256806-61-7 is the registry number for 5-Fluoro-2-(trifluoromethyl)-4-pyridinecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1256806-61-7) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: HMTABCCRCKKQSM-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | HMTABCCRCKKQSM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)