CAS 1256834-28-2 appears in our catalog under these names: Methyl 4,5–dichloropicolinate, Methyl 4,5-dichloropicolinate 95%, Methyl 4,5-dichloropicolinate, 98%, 98%, Methyl 4,5-dichloropicolinate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4,5-dichloropyridine-2-carboxylate (CAS 1256834-28-2) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 4,5-dichloropyridine-2-carboxylate. InChIKey: WVBZQZGENXXGJI-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 4,5-dichloropyridine-2-carboxylate |
| InChIKey | WVBZQZGENXXGJI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C(=C1)Cl)Cl |
Computed by PubChem (NCBI)