CAS 1256929-18-6 is the registry number for 2-Bromo-6,9-dihydropyrido[1,2-a]indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6,9-dihydropyrido[1,2-a]indole (CAS 1256929-18-6) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 2-bromo-6,9-dihydropyrido[1,2-a]indole. InChIKey: SXGGWMXTRIYYSX-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 2-bromo-6,9-dihydropyrido[1,2-a]indole |
| InChIKey | SXGGWMXTRIYYSX-UHFFFAOYSA-N |
| SMILES | C1C=CCN2C1=CC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)