CAS 1258154-58-3 is the registry number for 5-Formylbenzofuran-2-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
5-formyl-1-benzofuran-2-carbonitrile (CAS 1258154-58-3) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 5-formyl-1-benzofuran-2-carbonitrile. InChIKey: WSXIBCRETBRQRW-UHFFFAOYSA-N.
| Molecular formula | C10H5NO2 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 5-formyl-1-benzofuran-2-carbonitrile |
| InChIKey | WSXIBCRETBRQRW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=O)C=C(O2)C#N |
Computed by PubChem (NCBI)