CAS 942493-20-1 is the registry number for 7-Ethynylindoline-2,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-ethynyl-1H-indole-2,3-dione (CAS 942493-20-1) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 7-ethynyl-1H-indole-2,3-dione. InChIKey: BRVIVUHUNLOIAQ-UHFFFAOYSA-N.
| Molecular formula | C10H5NO2 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 7-ethynyl-1H-indole-2,3-dione |
| InChIKey | BRVIVUHUNLOIAQ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C(=CC=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)