Products 201995-00-8

CAS 201995-00-8 is the registry number for 3-(4-Cyanophenyl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-cyanophenyl)prop-2-ynoic acid (CAS 201995-00-8) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 3-(4-cyanophenyl)prop-2-ynoic acid. InChIKey: LVMXGFCGSSAHNB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5NO2
Molecular weight171.15 g/mol
IUPAC name3-(4-cyanophenyl)prop-2-ynoic acid
InChIKeyLVMXGFCGSSAHNB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C#CC(=O)O)C#N

Computed by PubChem (NCBI)