CAS 15119-34-3 appears in our catalog under these names: 3-Cyanocoumarin, 97%, Coumarin–3–carbonitrile, 3-Cyanocoumarin 98%, Coumarin-3-carbonitrile, >98.0%(GC), 2-oxo-2H-chromene-3-carbonitrile, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, TCI. Available pack sizes: 5g, 1g, 250mg, 25g, 2.5g, 10g.
2-oxochromene-3-carbonitrile (CAS 15119-34-3) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 2-oxochromene-3-carbonitrile. InChIKey: QKJALQPLNMEDAV-UHFFFAOYSA-N.
| Molecular formula | C10H5NO2 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 2-oxochromene-3-carbonitrile |
| InChIKey | QKJALQPLNMEDAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C#N |
Computed by PubChem (NCBI)