CAS 50396-61-7 appears in our catalog under these names: 2-Oxochromene-6-carbonitrile, 95%, 2-Oxo-2H-chromene-6-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
2-oxochromene-6-carbonitrile (CAS 50396-61-7) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 2-oxochromene-6-carbonitrile. InChIKey: MCSNBULGQKALQK-UHFFFAOYSA-N.
| Molecular formula | C10H5NO2 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 2-oxochromene-6-carbonitrile |
| InChIKey | MCSNBULGQKALQK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1C#N |
Computed by PubChem (NCBI)