CAS 1909309-81-4 appears in our catalog under these names: 4-Ethynyl-2,3-dihydro-1H-isoindole-1,3-dione, 4-Ethynyl-2,3-dihydro-1H-isoindole-1,3-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-ethynylisoindole-1,3-dione (CAS 1909309-81-4) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 4-ethynylisoindole-1,3-dione. InChIKey: SFOPWTGIYVGTRL-UHFFFAOYSA-N.
| Molecular formula | C10H5NO2 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 4-ethynylisoindole-1,3-dione |
| InChIKey | SFOPWTGIYVGTRL-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C(=CC=C1)C(=O)NC2=O |
Computed by PubChem (NCBI)