Products 2363048-11-5

CAS 2363048-11-5 is the registry number for 2,6-Diethynylisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,6-diethynylpyridine-4-carboxylic acid (CAS 2363048-11-5) is a chemical compound with the molecular formula C10H5NO2 and a molecular weight of 171.15 g/mol. IUPAC name: 2,6-diethynylpyridine-4-carboxylic acid. InChIKey: BSRCTZANUJEFFF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5NO2
Molecular weight171.15 g/mol
IUPAC name2,6-diethynylpyridine-4-carboxylic acid
InChIKeyBSRCTZANUJEFFF-UHFFFAOYSA-N
SMILESC#CC1=CC(=CC(=N1)C#C)C(=O)O

Computed by PubChem (NCBI)