Products 1258625-94-3
CAS 1258625-94-3 appears in our catalog under these names: 3-(4-Hydroxyphenyl)isonicotinic acid, 98%, 3-(4-Hydroxyphenyl)isonicotinic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-(4-hydroxyphenyl)pyridine-4-carboxylic acid (CAS 1258625-94-3) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 3-(4-hydroxyphenyl)pyridine-4-carboxylic acid. InChIKey: LPRGOILDLJZQEH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)pyridine-4-carboxylic acid |
| InChIKey | LPRGOILDLJZQEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=CN=C2)C(=O)O)O |
Computed by PubChem (NCBI)