CAS 1258652-39-9 appears in our catalog under these names: 5-Fluoro-2,4-dimethoxybenzene-1-sulfonyl chloride, 95%, 5-Fluoro-2,4-dimethoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-fluoro-2,4-dimethoxybenzenesulfonyl chloride (CAS 1258652-39-9) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 5-fluoro-2,4-dimethoxybenzenesulfonyl chloride. InChIKey: GMVNHDODUORGAB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO4S |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 5-fluoro-2,4-dimethoxybenzenesulfonyl chloride |
| InChIKey | GMVNHDODUORGAB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1F)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)