CAS 2126161-66-6 is the registry number for 5-Fluoro-2-(methoxymethoxy)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-fluoro-2-(methoxymethoxy)benzenesulfonyl chloride (CAS 2126161-66-6) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 5-fluoro-2-(methoxymethoxy)benzenesulfonyl chloride. InChIKey: BKFLRNWHLCWVMK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO4S |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 5-fluoro-2-(methoxymethoxy)benzenesulfonyl chloride |
| InChIKey | BKFLRNWHLCWVMK-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)