Products 1785469-82-0

CAS 1785469-82-0 is the registry number for 2-Fluoro-4,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-fluoro-4,6-dimethoxybenzenesulfonyl chloride (CAS 1785469-82-0) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 2-fluoro-4,6-dimethoxybenzenesulfonyl chloride. InChIKey: CJJOGTOPXQBUDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO4S
Molecular weight254.66 g/mol
IUPAC name2-fluoro-4,6-dimethoxybenzenesulfonyl chloride
InChIKeyCJJOGTOPXQBUDJ-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C(=C1)F)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)