CAS 1785469-82-0 is the registry number for 2-Fluoro-4,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-4,6-dimethoxybenzenesulfonyl chloride (CAS 1785469-82-0) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 2-fluoro-4,6-dimethoxybenzenesulfonyl chloride. InChIKey: CJJOGTOPXQBUDJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO4S |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 2-fluoro-4,6-dimethoxybenzenesulfonyl chloride |
| InChIKey | CJJOGTOPXQBUDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)