CAS 1803810-20-9 is the registry number for 4-Fluoro-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2,6-dimethoxybenzenesulfonyl chloride (CAS 1803810-20-9) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 4-fluoro-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: DXOLCEBTFSFQSL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO4S |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 4-fluoro-2,6-dimethoxybenzenesulfonyl chloride |
| InChIKey | DXOLCEBTFSFQSL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1S(=O)(=O)Cl)OC)F |
Computed by PubChem (NCBI)