Products 1803810-20-9

CAS 1803810-20-9 is the registry number for 4-Fluoro-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-fluoro-2,6-dimethoxybenzenesulfonyl chloride (CAS 1803810-20-9) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 4-fluoro-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: DXOLCEBTFSFQSL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO4S
Molecular weight254.66 g/mol
IUPAC name4-fluoro-2,6-dimethoxybenzenesulfonyl chloride
InChIKeyDXOLCEBTFSFQSL-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1S(=O)(=O)Cl)OC)F

Computed by PubChem (NCBI)