Products 2891824-47-6

CAS 2891824-47-6 is the registry number for 2-Fluoro-6-(methoxymethoxy)benzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-fluoro-6-(methoxymethoxy)benzenesulfonyl chloride (CAS 2891824-47-6) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 2-fluoro-6-(methoxymethoxy)benzenesulfonyl chloride. InChIKey: ZWUNGSGOENAHLE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO4S
Molecular weight254.66 g/mol
IUPAC name2-fluoro-6-(methoxymethoxy)benzenesulfonyl chloride
InChIKeyZWUNGSGOENAHLE-UHFFFAOYSA-N
SMILESCOCOC1=C(C(=CC=C1)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)