Products 656806-43-8

CAS 656806-43-8 appears in our catalog under these names: 2-Fluoro-4,5-dimethoxybenzene-1-sulfonyl chloride, 95+%, 2-Fluoro-4,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-4,5-dimethoxybenzenesulfonyl chloride (CAS 656806-43-8) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 2-fluoro-4,5-dimethoxybenzenesulfonyl chloride. InChIKey: MTCNVXSVITXLCE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO4S
Molecular weight254.66 g/mol
IUPAC name2-fluoro-4,5-dimethoxybenzenesulfonyl chloride
InChIKeyMTCNVXSVITXLCE-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1OC)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)