CAS 656806-43-8 appears in our catalog under these names: 2-Fluoro-4,5-dimethoxybenzene-1-sulfonyl chloride, 95+%, 2-Fluoro-4,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-fluoro-4,5-dimethoxybenzenesulfonyl chloride (CAS 656806-43-8) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 2-fluoro-4,5-dimethoxybenzenesulfonyl chloride. InChIKey: MTCNVXSVITXLCE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO4S |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 2-fluoro-4,5-dimethoxybenzenesulfonyl chloride |
| InChIKey | MTCNVXSVITXLCE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1OC)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)