Products 1780188-39-7

CAS 1780188-39-7 is the registry number for 6-Fluoro-2,3-dimethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-fluoro-2,3-dimethoxybenzenesulfonyl chloride (CAS 1780188-39-7) is a chemical compound with the molecular formula C8H8ClFO4S and a molecular weight of 254.66 g/mol. IUPAC name: 6-fluoro-2,3-dimethoxybenzenesulfonyl chloride. InChIKey: VDLDVCVWWUEWPF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO4S
Molecular weight254.66 g/mol
IUPAC name6-fluoro-2,3-dimethoxybenzenesulfonyl chloride
InChIKeyVDLDVCVWWUEWPF-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)F)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)