Products 1259778-48-7
CAS 1259778-48-7 is the registry number for (S)-5,6-Dichloro-2,3-dihydro-1H-inden-1-amine, 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(1S)-5,6-dichloro-2,3-dihydro-1H-inden-1-amine (CAS 1259778-48-7) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: (1S)-5,6-dichloro-2,3-dihydro-1H-inden-1-amine. InChIKey: XWCCMCNCBDSVFJ-VIFPVBQESA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | (1S)-5,6-dichloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | XWCCMCNCBDSVFJ-VIFPVBQESA-N |
| SMILES | C1CC2=CC(=C(C=C2[C@H]1N)Cl)Cl |
Computed by PubChem (NCBI)