Products 1260011-21-9
CAS 1260011-21-9 appears in our catalog under these names: 5-Bromo-4-nitro-2,3-dihydro-1H-inden-1-one, 95%, 95%, 5-Bromo-4-nitro-2,3-dihydro-1H-inden-1-one, 98%, 5-Bromo-4-nitro-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-4-nitro-2,3-dihydroinden-1-one (CAS 1260011-21-9) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 5-bromo-4-nitro-2,3-dihydroinden-1-one. InChIKey: DVMCINNTHXEASL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 5-bromo-4-nitro-2,3-dihydroinden-1-one |
| InChIKey | DVMCINNTHXEASL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)