CAS 1260012-31-4 appears in our catalog under these names: 6-Chloro-5-hydroxy-2,3-dihydro-1H-inden-1-one, 95%, 6-Chloro-5-hydroxy-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-chloro-5-hydroxy-2,3-dihydroinden-1-one (CAS 1260012-31-4) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 6-chloro-5-hydroxy-2,3-dihydroinden-1-one. InChIKey: YVXYZYKHRJQSPT-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 6-chloro-5-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | YVXYZYKHRJQSPT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)O)Cl |
Computed by PubChem (NCBI)