Products 1260018-07-2
CAS 1260018-07-2 is the registry number for 7-bromo-4-nitro-indan-1-one, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-bromo-4-nitro-2,3-dihydroinden-1-one (CAS 1260018-07-2) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 7-bromo-4-nitro-2,3-dihydroinden-1-one. InChIKey: GJJGSYXLPQZJSM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 7-bromo-4-nitro-2,3-dihydroinden-1-one |
| InChIKey | GJJGSYXLPQZJSM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)