CAS 1260593-30-3 is the registry number for 2,4-Difluoro-L-homophenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-amino-4-(2,4-difluorophenyl)butanoic acid (CAS 1260593-30-3) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: (2S)-2-amino-4-(2,4-difluorophenyl)butanoic acid. InChIKey: RXTYJIYAYABQKD-VIFPVBQESA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | (2S)-2-amino-4-(2,4-difluorophenyl)butanoic acid |
| InChIKey | RXTYJIYAYABQKD-VIFPVBQESA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)