Products 1260593-66-5
CAS 1260593-66-5 is the registry number for 1-(tert-Butyl) 2-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate hydrochloride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate;hydrochloride (CAS 1260593-66-5) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate;hydrochloride. InChIKey: PXHWVFRNYYJQOO-RJUBDTSPSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | PXHWVFRNYYJQOO-RJUBDTSPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C[C@H]1C(=O)OC)N.Cl |
Computed by PubChem (NCBI)