CAS 1262849-90-0 appears in our catalog under these names: (3R,4S)-4-Amino-1-boc-3-pyrrolidinecarboxylic acid ethyl ester hydrochloride, 95%, (3R,4S)-1-tert-Butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate hydrochloride, 98+%, (3R,4S)-4-AMINO-1-BOC-3-PYRROLIDINECARBOXYLIC ACID ETHYL ESTER HCL, 95%, 95%, (3R,4S)-4-AMINO-1-BOC-3-PYRROLIDINECARBOXYLIC ACID ETHYL ESTER HCL, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g.
1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride (CAS 1262849-90-0) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride. InChIKey: HBFTTYWPCPPDIT-VTLYIQCISA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride |
| InChIKey | HBFTTYWPCPPDIT-VTLYIQCISA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)