CAS 1357073-13-2 appears in our catalog under these names: Trans-4-amino-1-n-boc-3-pyrrolidinecarboxylic acid ethyl ester hydrochloride, 95%, Trans-4-amino-1-n-boc-3-pyrrolidinecarboxylic acid ethyl ester hcl, 99%, 99%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1-O-tert-butyl 3-O-ethyl (3S,4R)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride (CAS 1357073-13-2) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride. InChIKey: HBFTTYWPCPPDIT-OZZZDHQUSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride |
| InChIKey | HBFTTYWPCPPDIT-OZZZDHQUSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)