Products 362690-46-8
CAS 362690-46-8 appears in our catalog under these names: 4-(tert-Butoxycarbonyl)-1-(2-carboxyethyl)piperazin-1-ium chloride, 98%, 3-{4-[(tert-butoxy)carbonyl]piperazin-1-yl}propanoic acid hydrochloride, 98%, 98%, 3-{4-[(tert-butoxy)carbonyl]piperazin-1-yl}propanoic acid hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g, 10g, 2.5g.
3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid;hydrochloride (CAS 362690-46-8) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid;hydrochloride. InChIKey: NLYNMXIPFLBLKT-UHFFFAOYSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid;hydrochloride |
| InChIKey | NLYNMXIPFLBLKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CCC(=O)O.Cl |
Computed by PubChem (NCBI)