CAS 1233501-65-9 appears in our catalog under these names: Cis-1-tert-butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate hydrochloride, 95%, cis-1-tert-Butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg.
1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride (CAS 1233501-65-9) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride. InChIKey: HBFTTYWPCPPDIT-OULXEKPRSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride |
| InChIKey | HBFTTYWPCPPDIT-OULXEKPRSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)