Products 1253789-34-2

CAS 1253789-34-2 is the registry number for Hexahydro-1H-1,4-Diazepine-1,2-dicarboxylic Acid 1-(1,1-Dimethylethyl) 2-Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl 1,4-diazepane-1,2-dicarboxylate;hydrochloride (CAS 1253789-34-2) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 1,4-diazepane-1,2-dicarboxylate;hydrochloride. InChIKey: DLVMNRDBDUFPDW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O4
Molecular weight294.77 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 1,4-diazepane-1,2-dicarboxylate;hydrochloride
InChIKeyDLVMNRDBDUFPDW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCNCC1C(=O)OC.Cl

Computed by PubChem (NCBI)