Products 2089316-56-1

CAS 2089316-56-1 is the registry number for 1-tert-Butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl 4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride (CAS 2089316-56-1) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride. InChIKey: HBFTTYWPCPPDIT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O4
Molecular weight294.77 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl 4-aminopyrrolidine-1,3-dicarboxylate;hydrochloride
InChIKeyHBFTTYWPCPPDIT-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC1N)C(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)