Products 2803376-33-0
CAS 2803376-33-0 is the registry number for 1-(tert-Butyl) 3-methyl (3S,5R)-5-aminopiperidine-1,3-dicarboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
1-O-tert-butyl 3-O-methyl (3S,5R)-5-aminopiperidine-1,3-dicarboxylate;hydrochloride (CAS 2803376-33-0) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,5R)-5-aminopiperidine-1,3-dicarboxylate;hydrochloride. InChIKey: OPUPSKVNCAQGFZ-OULXEKPRSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,5R)-5-aminopiperidine-1,3-dicarboxylate;hydrochloride |
| InChIKey | OPUPSKVNCAQGFZ-OULXEKPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H](C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)