Products 1260597-00-9
CAS 1260597-00-9 appears in our catalog under these names: H-HoPhe(3,5-DiCl)-OH, 95%, (S)-2-Amino-4-(3,5-dichlorophenyl)butanoic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
(2S)-2-amino-4-(3,5-dichlorophenyl)butanoic acid (CAS 1260597-00-9) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: (2S)-2-amino-4-(3,5-dichlorophenyl)butanoic acid. InChIKey: KGZBOALXMBRBMM-VIFPVBQESA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | (2S)-2-amino-4-(3,5-dichlorophenyl)butanoic acid |
| InChIKey | KGZBOALXMBRBMM-VIFPVBQESA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)