CAS 126067-48-9 is the registry number for 1-(2,4-Dichlorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 126067-48-9) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: KGCCBXHSOMDSPJ-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid |
| InChIKey | KGCCBXHSOMDSPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)