Products 126067-48-9

CAS 126067-48-9 is the registry number for 1-(2,4-Dichlorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 126067-48-9) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: KGCCBXHSOMDSPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8Cl2N2O2
Molecular weight271.10 g/mol
IUPAC name1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid
InChIKeyKGCCBXHSOMDSPJ-UHFFFAOYSA-N
SMILESCC1=CC(=NN1C2=C(C=C(C=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)