Products 1260676-14-9
CAS 1260676-14-9 is the registry number for Methyl 2,4-dichloroquinoline-6-carboxylate, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,4-dichloroquinoline-6-carboxylate (CAS 1260676-14-9) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: methyl 2,4-dichloroquinoline-6-carboxylate. InChIKey: UYGJEIXOUMWPLS-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | methyl 2,4-dichloroquinoline-6-carboxylate |
| InChIKey | UYGJEIXOUMWPLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)