CAS 126069-80-5 is the registry number for 2-(2-(N-(3-Nitrophenyl)carbamoyl)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g.
2-[2-[(3-nitrophenyl)carbamoyl]phenyl]acetic acid (CAS 126069-80-5) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: 2-[2-[(3-nitrophenyl)carbamoyl]phenyl]acetic acid. InChIKey: NRNCPFWSAOSRER-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O5 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | 2-[2-[(3-nitrophenyl)carbamoyl]phenyl]acetic acid |
| InChIKey | NRNCPFWSAOSRER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)