Products 402934-69-4
CAS 402934-69-4 is the registry number for NAA-004. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[[4-(carboxymethyl)phenyl]diazenyl]-2-hydroxybenzoic acid (CAS 402934-69-4) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: 5-[[4-(carboxymethyl)phenyl]diazenyl]-2-hydroxybenzoic acid. InChIKey: FNRNBCNUWGWVFO-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O5 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | 5-[[4-(carboxymethyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
| InChIKey | FNRNBCNUWGWVFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)N=NC2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)