CAS 1260777-27-2 is the registry number for 5-((4-Fluorophenyl)methyl)-1,2,4-oxadiazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-amine (CAS 1260777-27-2) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: 5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-amine. InChIKey: TWPDMJKXUYUWBI-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-amine |
| InChIKey | TWPDMJKXUYUWBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC(=NO2)N)F |
Computed by PubChem (NCBI)