CAS 1260777-34-1 appears in our catalog under these names: 3-Methylimidazo(1,5-a)pyridine-6-carboxylic acid, 3-Methylimidazo[1,5-a]pyridine-6-carboxylic acid, 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-methylimidazo[1,5-a]pyridine-6-carboxylic acid (CAS 1260777-34-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-methylimidazo[1,5-a]pyridine-6-carboxylic acid. InChIKey: KJQILHKNEOBPPU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-methylimidazo[1,5-a]pyridine-6-carboxylic acid |
| InChIKey | KJQILHKNEOBPPU-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2N1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)