Products 1424397-79-4
CAS 1424397-79-4 is the registry number for 3,4-Dichloro-N-(4-hydroxybutan-2-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-N-(4-hydroxybutan-2-yl)benzamide (CAS 1424397-79-4) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: 3,4-dichloro-N-(4-hydroxybutan-2-yl)benzamide. InChIKey: QWRVYQHOWJGDRN-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 3,4-dichloro-N-(4-hydroxybutan-2-yl)benzamide |
| InChIKey | QWRVYQHOWJGDRN-UHFFFAOYSA-N |
| SMILES | CC(CCO)NC(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)