Products 1260780-18-4

CAS 1260780-18-4 is the registry number for Ethyl 2-(3-aminophenyl)-2,2-difluoroacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2-(3-aminophenyl)-2,2-difluoroacetate (CAS 1260780-18-4) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: ethyl 2-(3-aminophenyl)-2,2-difluoroacetate. InChIKey: SYALPIKTAYQDAK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11F2NO2
Molecular weight215.20 g/mol
IUPAC nameethyl 2-(3-aminophenyl)-2,2-difluoroacetate
InChIKeySYALPIKTAYQDAK-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC(=CC=C1)N)(F)F

Computed by PubChem (NCBI)