CAS 1260862-43-8 appears in our catalog under these names: 4-(Difluoromethoxy)-2,6-difluorobenzonitrile, 95%, 4–(Difluoromethoxy)–2,6–difluorobenzonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 25g, 10g, 1g.
4-(difluoromethoxy)-2,6-difluorobenzonitrile (CAS 1260862-43-8) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 4-(difluoromethoxy)-2,6-difluorobenzonitrile. InChIKey: UKUBMSGIMQDVNC-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 4-(difluoromethoxy)-2,6-difluorobenzonitrile |
| InChIKey | UKUBMSGIMQDVNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C#N)F)OC(F)F |
Computed by PubChem (NCBI)